C30H38BBrN4O2 — CID 157322591
(6-amino-3-pyridinyl)boronic acid;1-bromo-3-tert-butylbenzene;5-(3-tert-butylphenyl)pyridin-2-amine (PubChem CID 157322591) has the molecular formula C30H38BBrN4O2 and a molecular weight of 577.38 g/mol. Its IUPAC name is (6-amino-3-pyridinyl)boronic acid;1-bromo-3-tert-butylbenzene;5-(3-tert-butylphenyl)pyridin-2-amine.
| Compound Name | (6-amino-3-pyridinyl)boronic acid;1-bromo-3-tert-butylbenzene;5-(3-tert-butylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 157322591 |
| Molecular Formula | C30H38BBrN4O2 |
| Molecular Weight | 577.38 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | (6-amino-3-pyridinyl)boronic acid;1-bromo-3-tert-butylbenzene;5-(3-tert-butylphenyl)pyridin-2-amine |
| SMILES | CC(C)(C)c1cccc(-c2ccc(N)nc2)c1.CC(C)(C)c1cccc(Br)c1.Nc1ccc(B(O)O)cn1 |
| InChI | InChI=1S/C15H18N2.C10H13Br.C5H7BN2O2/c1-15(2,3)13-6-4-5-11(9-13)12-7-8-14(16)17-10-12;1-10(2,3)8-5-4-6-9(11)7-8;7-5-2-1-4(3-8-5)6(9)10/h4-10H,1-3H3,(H2,16,17);4-7H,1-3H3;1-3,9-10H,(H2,7,8) |
| InChIKey | BEIOYIQIJFTZIB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.38 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|