C21H17BBr2N4O2 — CID 157357203
2,5-dibromo-4-methylpyridine;(4,6-diphenyl-1,3,5-triazin-2-yl)boronic acid (PubChem CID 157357203) has the molecular formula C21H17BBr2N4O2 and a molecular weight of 528.01 g/mol. Its IUPAC name is 2,5-dibromo-4-methylpyridine;(4,6-diphenyl-1,3,5-triazin-2-yl)boronic acid.
| Compound Name | 2,5-dibromo-4-methylpyridine;(4,6-diphenyl-1,3,5-triazin-2-yl)boronic acid |
|---|---|
| PubChem CID | 157357203 |
| Molecular Formula | C21H17BBr2N4O2 |
| Molecular Weight | 528.01 g/mol |
| Exact Mass | 525.98 |
| IUPAC Name | 2,5-dibromo-4-methylpyridine;(4,6-diphenyl-1,3,5-triazin-2-yl)boronic acid |
| SMILES | Cc1cc(Br)ncc1Br.OB(O)c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H12BN3O2.C6H5Br2N/c20-16(21)15-18-13(11-7-3-1-4-8-11)17-14(19-15)12-9-5-2-6-10-12;1-4-2-6(8)9-3-5(4)7/h1-10,20-21H;2-3H,1H3 |
| InChIKey | BIFOGHINLMGVFU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.01 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|