C18H27ClN4O3 — CID 157322851
2-[4-[3-(6-methoxyquinazolin-2-yl)oxypropyl]piperazin-1-yl]ethanol;hydrochloride (PubChem CID 157322851) has the molecular formula C18H27ClN4O3 and a molecular weight of 382.89 g/mol. Its IUPAC name is 2-[4-[3-(6-methoxyquinazolin-2-yl)oxypropyl]piperazin-1-yl]ethanol;hydrochloride.
| Compound Name | 2-[4-[3-(6-methoxyquinazolin-2-yl)oxypropyl]piperazin-1-yl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 157322851 |
| Molecular Formula | C18H27ClN4O3 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 2-[4-[3-(6-methoxyquinazolin-2-yl)oxypropyl]piperazin-1-yl]ethanol;hydrochloride |
| SMILES | COc1ccc2nc(OCCCN3CCN(CCO)CC3)ncc2c1.Cl |
| InChI | InChI=1S/C18H26N4O3.ClH/c1-24-16-3-4-17-15(13-16)14-19-18(20-17)25-12-2-5-21-6-8-22(9-7-21)10-11-23;/h3-4,13-14,23H,2,5-12H2,1H3;1H |
| InChIKey | GNENZLZGLJYNQO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|