C16H18N2O5 — CID 157337156
2-(1H-indol-3-ylmethyl)-5-(methoxycarbonylamino)-4-oxopentanoic acid (PubChem CID 157337156) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-(1H-indol-3-ylmethyl)-5-(methoxycarbonylamino)-4-oxopentanoic acid.
| Compound Name | 2-(1H-indol-3-ylmethyl)-5-(methoxycarbonylamino)-4-oxopentanoic acid |
|---|---|
| PubChem CID | 157337156 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-(1H-indol-3-ylmethyl)-5-(methoxycarbonylamino)-4-oxopentanoic acid |
| SMILES | COC(=O)NCC(=O)CC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H18N2O5/c1-23-16(22)18-9-12(19)7-10(15(20)21)6-11-8-17-14-5-3-2-4-13(11)14/h2-5,8,10,17H,6-7,9H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | JFXKQMVRBIRXBV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |