C20H22N4O3 — CID 44612848
methyl N-[(1S)-1-(benzylcarbamoylamino)-2-(1H-indol-3-yl)ethyl]carbamate (PubChem CID 44612848) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is methyl N-[(1S)-1-(benzylcarbamoylamino)-2-(1H-indol-3-yl)ethyl]carbamate.
| Compound Name | methyl N-[(1S)-1-(benzylcarbamoylamino)-2-(1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 44612848 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | methyl N-[(1S)-1-(benzylcarbamoylamino)-2-(1H-indol-3-yl)ethyl]carbamate |
| SMILES | COC(=O)N[C@@H](Cc1c[nH]c2ccccc12)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H22N4O3/c1-27-20(26)24-18(11-15-13-21-17-10-6-5-9-16(15)17)23-19(25)22-12-14-7-3-2-4-8-14/h2-10,13,18,21H,11-12H2,1H3,(H,24,26)(H2,22,23,25)/t18-/m0/s1 |
| InChIKey | NJIYBOLRHFUNAR-SFHVURJKSA-N |
| XLogP | 2.89 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|