C33H32N6O2 — CID 157337758
N-[3-[8-amino-1-[4-(2-pyridin-2-ylacetyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-1-adamantyl]but-2-ynamide (PubChem CID 157337758) has the molecular formula C33H32N6O2 and a molecular weight of 544.66 g/mol. Its IUPAC name is N-[3-[8-amino-1-[4-(2-pyridin-2-ylacetyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-1-adamantyl]but-2-ynamide.
| Compound Name | N-[3-[8-amino-1-[4-(2-pyridin-2-ylacetyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-1-adamantyl]but-2-ynamide |
|---|---|
| PubChem CID | 157337758 |
| Molecular Formula | C33H32N6O2 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | N-[3-[8-amino-1-[4-(2-pyridin-2-ylacetyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-1-adamantyl]but-2-ynamide |
| SMILES | CC#CC(=O)NC12CC3CC(C1)CC(c1nc(-c4ccc(C(=O)Cc5ccccn5)cc4)c4c(N)nccn14)(C3)C2 |
| InChI | InChI=1S/C33H32N6O2/c1-2-5-27(41)38-33-18-21-14-22(19-33)17-32(16-21,20-33)31-37-28(29-30(34)36-12-13-39(29)31)24-9-7-23(8-10-24)26(40)15-25-6-3-4-11-35-25/h3-4,6-13,21-22H,14-20H2,1H3,(H2,34,36)(H,38,41) |
| InChIKey | BGAPYPFXVUOTRL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|