C32H43ClN12O6 — CID 157339426
tert-butyl 4-[6-[[4-(cyclopentylamino)-5-nitropyrimidin-2-yl]amino]-3-pyridinyl]piperazine-1-carboxylate;2-chloro-N-cyclopentyl-5-nitropyrimidin-4-amine (PubChem CID 157339426) has the molecular formula C32H43ClN12O6 and a molecular weight of 727.23 g/mol. Its IUPAC name is tert-butyl 4-[6-[[4-(cyclopentylamino)-5-nitropyrimidin-2-yl]amino]-3-pyridinyl]piperazine-1-carboxylate;2-chloro-N-cyclopentyl-5-nitropyrimidin-4-amine.
| Compound Name | tert-butyl 4-[6-[[4-(cyclopentylamino)-5-nitropyrimidin-2-yl]amino]-3-pyridinyl]piperazine-1-carboxylate;2-chloro-N-cyclopentyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 157339426 |
| Molecular Formula | C32H43ClN12O6 |
| Molecular Weight | 727.23 g/mol |
| Exact Mass | 726.31 |
| IUPAC Name | tert-butyl 4-[6-[[4-(cyclopentylamino)-5-nitropyrimidin-2-yl]amino]-3-pyridinyl]piperazine-1-carboxylate;2-chloro-N-cyclopentyl-5-nitropyrimidin-4-amine |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Nc3ncc([N+](=O)[O-])c(NC4CCCC4)n3)nc2)CC1.O=[N+]([O-])c1cnc(Cl)nc1NC1CCCC1 |
| InChI | InChI=1S/C23H32N8O4.C9H11ClN4O2/c1-23(2,3)35-22(32)30-12-10-29(11-13-30)17-8-9-19(24-14-17)27-21-25-15-18(31(33)34)20(28-21)26-16-6-4-5-7-16;10-9-11-5-7(14(15)16)8(13-9)12-6-3-1-2-4-6/h8-9,14-16H,4-7,10-13H2,1-3H3,(H2,24,25,26,27,28);5-6H,1-4H2,(H,11,12,13) |
| InChIKey | BGFMESUXXGJTRV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 219.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.23 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|