C22H24N2O — CID 157341167
1-[3-[2-[3-(4-methylphenyl)propyl]pyrimidin-4-yl]phenyl]ethanol (PubChem CID 157341167) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-[3-[2-[3-(4-methylphenyl)propyl]pyrimidin-4-yl]phenyl]ethanol.
| Compound Name | 1-[3-[2-[3-(4-methylphenyl)propyl]pyrimidin-4-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 157341167 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 1-[3-[2-[3-(4-methylphenyl)propyl]pyrimidin-4-yl]phenyl]ethanol |
| SMILES | Cc1ccc(CCCc2nccc(-c3cccc(C(C)O)c3)n2)cc1 |
| InChI | InChI=1S/C22H24N2O/c1-16-9-11-18(12-10-16)5-3-8-22-23-14-13-21(24-22)20-7-4-6-19(15-20)17(2)25/h4,6-7,9-15,17,25H,3,5,8H2,1-2H3 |
| InChIKey | BYONTOYNQWDJES-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |