C24H31N5 — CID 70882348
N'-[1-[3-[2-[2-(4-methylphenyl)ethylamino]pyrimidin-4-yl]phenyl]ethyl]propane-1,3-diamine (PubChem CID 70882348) has the molecular formula C24H31N5 and a molecular weight of 389.55 g/mol. Its IUPAC name is N'-[1-[3-[2-[2-(4-methylphenyl)ethylamino]pyrimidin-4-yl]phenyl]ethyl]propane-1,3-diamine.
| Compound Name | N'-[1-[3-[2-[2-(4-methylphenyl)ethylamino]pyrimidin-4-yl]phenyl]ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 70882348 |
| Molecular Formula | C24H31N5 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | N'-[1-[3-[2-[2-(4-methylphenyl)ethylamino]pyrimidin-4-yl]phenyl]ethyl]propane-1,3-diamine |
| SMILES | Cc1ccc(CCNc2nccc(-c3cccc(C(C)NCCCN)c3)n2)cc1 |
| InChI | InChI=1S/C24H31N5/c1-18-7-9-20(10-8-18)11-15-27-24-28-16-12-23(29-24)22-6-3-5-21(17-22)19(2)26-14-4-13-25/h3,5-10,12,16-17,19,26H,4,11,13-15,25H2,1-2H3,(H,27,28,29) |
| InChIKey | KGXYAGKRQDYHKU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|