C21H23N3O3 — CID 67045057
4-[2-[[4-[3-(dimethoxymethyl)phenyl]pyrimidin-2-yl]amino]ethyl]phenol (PubChem CID 67045057) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[2-[[4-[3-(dimethoxymethyl)phenyl]pyrimidin-2-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[4-[3-(dimethoxymethyl)phenyl]pyrimidin-2-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 67045057 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4-[2-[[4-[3-(dimethoxymethyl)phenyl]pyrimidin-2-yl]amino]ethyl]phenol |
| SMILES | COC(OC)c1cccc(-c2ccnc(NCCc3ccc(O)cc3)n2)c1 |
| InChI | InChI=1S/C21H23N3O3/c1-26-20(27-2)17-5-3-4-16(14-17)19-11-13-23-21(24-19)22-12-10-15-6-8-18(25)9-7-15/h3-9,11,13-14,20,25H,10,12H2,1-2H3,(H,22,23,24) |
| InChIKey | COBZKBLBYWWDKL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|