C22H24N2OSi — CID 157342063
[6-([1]benzofuro[2,3-b]pyridin-3-yl)-4-propan-2-yl-3-pyridinyl]-trimethylsilane (PubChem CID 157342063) has the molecular formula C22H24N2OSi and a molecular weight of 360.53 g/mol. Its IUPAC name is [6-([1]benzofuro[2,3-b]pyridin-3-yl)-4-propan-2-yl-3-pyridinyl]-trimethylsilane.
| Compound Name | [6-([1]benzofuro[2,3-b]pyridin-3-yl)-4-propan-2-yl-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 157342063 |
| Molecular Formula | C22H24N2OSi |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | [6-([1]benzofuro[2,3-b]pyridin-3-yl)-4-propan-2-yl-3-pyridinyl]-trimethylsilane |
| SMILES | CC(C)c1cc(-c2cnc3oc4ccccc4c3c2)ncc1[Si](C)(C)C |
| InChI | InChI=1S/C22H24N2OSi/c1-14(2)17-11-19(23-13-21(17)26(3,4)5)15-10-18-16-8-6-7-9-20(16)25-22(18)24-12-15/h6-14H,1-5H3 |
| InChIKey | QPMQJBJEJKOIAF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|