C21H36N2O — CID 157342075
(2S)-2-benzyl-N,3-dimethyl-N-[5-(propan-2-ylamino)pentyl]butanamide (PubChem CID 157342075) has the molecular formula C21H36N2O and a molecular weight of 332.53 g/mol. Its IUPAC name is (2S)-2-benzyl-N,3-dimethyl-N-[5-(propan-2-ylamino)pentyl]butanamide.
| Compound Name | (2S)-2-benzyl-N,3-dimethyl-N-[5-(propan-2-ylamino)pentyl]butanamide |
|---|---|
| PubChem CID | 157342075 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | (2S)-2-benzyl-N,3-dimethyl-N-[5-(propan-2-ylamino)pentyl]butanamide |
| SMILES | CC(C)NCCCCCN(C)C(=O)[C@@H](Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C21H36N2O/c1-17(2)20(16-19-12-8-6-9-13-19)21(24)23(5)15-11-7-10-14-22-18(3)4/h6,8-9,12-13,17-18,20,22H,7,10-11,14-16H2,1-5H3/t20-/m0/s1 |
| InChIKey | OJQVBDDQGHCEME-FQEVSTJZSA-N |
| XLogP | 4.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|