About bis(butan-2-yl(ethyl)phosphinic acid);iron
bis(butan-2-yl(ethyl)phosphinic acid);iron (PubChem CID 157342521) has the molecular formula C12H30FeO4P2
and a molecular weight of 356.16 g/mol. Its IUPAC name is bis(butan-2-yl(ethyl)phosphinic acid);iron.
Molecular Properties
| Compound Name | bis(butan-2-yl(ethyl)phosphinic acid);iron |
| PubChem CID | 157342521 |
| Molecular Formula | C12H30FeO4P2 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | bis(butan-2-yl(ethyl)phosphinic acid);iron |
| SMILES | CCC(C)P(=O)(O)CC.CCC(C)P(=O)(O)CC.[Fe] |
| InChI | InChI=1S/2C6H15O2P.Fe/c2*1-4-6(3)9(7,8)5-2;/h2*6H,4-5H2,1-3H3,(H,7,8); |
| InChIKey | BGOISCAGHHJFIN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(butan-2-yl(ethyl)phosphinic acid);iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(butan-2-yl(ethyl)phosphinic acid);iron?
The IUPAC name of bis(butan-2-yl(ethyl)phosphinic acid);iron (CID 157342521) is bis(butan-2-yl(ethyl)phosphinic acid);iron.
What is the SMILES notation for bis(butan-2-yl(ethyl)phosphinic acid);iron?
The canonical SMILES for bis(butan-2-yl(ethyl)phosphinic acid);iron is CCC(C)P(=O)(O)CC.CCC(C)P(=O)(O)CC.[Fe].
What is the InChIKey of bis(butan-2-yl(ethyl)phosphinic acid);iron?
The InChIKey is BGOISCAGHHJFIN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H15O2P.Fe/c2*1-4-6(3)9(7,8)5-2;/h2*6H,4-5H2,1-3H3,(H,7,8);.
What are the key properties of bis(butan-2-yl(ethyl)phosphinic acid);iron?
bis(butan-2-yl(ethyl)phosphinic acid);iron has a molecular weight of 356.16 g/mol, XLogP of 4.15, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(butan-2-yl(ethyl)phosphinic acid);iron is sourced from PubChem (CID 157342521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).