C6H20IO3P2+ — CID 175282651
ethyl(trimethyl)phosphanium;methylphosphonic acid;hydroiodide (PubChem CID 175282651) has the molecular formula C6H20IO3P2+ and a molecular weight of 329.08 g/mol. Its IUPAC name is ethyl(trimethyl)phosphanium;methylphosphonic acid;hydroiodide.
| Compound Name | ethyl(trimethyl)phosphanium;methylphosphonic acid;hydroiodide |
|---|---|
| PubChem CID | 175282651 |
| Molecular Formula | C6H20IO3P2+ |
| Molecular Weight | 329.08 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | ethyl(trimethyl)phosphanium;methylphosphonic acid;hydroiodide |
| SMILES | CC[P+](C)(C)C.CP(=O)(O)O.I |
| InChI | InChI=1S/C5H14P.CH5O3P.HI/c1-5-6(2,3)4;1-5(2,3)4;/h5H2,1-4H3;1H3,(H2,2,3,4);1H/q+1;; |
| InChIKey | FPXLUDQHVYWNTK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.08 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|