C33H33F2N5O4 — CID 157344961
1-[1-[2-[3-fluoro-4-[3-(3-morpholin-4-ylpropylamino)pyrido[2,3-b]pyrazin-8-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone (PubChem CID 157344961) has the molecular formula C33H33F2N5O4 and a molecular weight of 601.65 g/mol. Its IUPAC name is 1-[1-[2-[3-fluoro-4-[3-(3-morpholin-4-ylpropylamino)pyrido[2,3-b]pyrazin-8-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[1-[2-[3-fluoro-4-[3-(3-morpholin-4-ylpropylamino)pyrido[2,3-b]pyrazin-8-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 157344961 |
| Molecular Formula | C33H33F2N5O4 |
| Molecular Weight | 601.65 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 1-[1-[2-[3-fluoro-4-[3-(3-morpholin-4-ylpropylamino)pyrido[2,3-b]pyrazin-8-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)C1(C(=O)Cc2ccc(Oc3ccnc4nc(NCCCN5CCOCC5)cnc34)c(F)c2)CC1 |
| InChI | InChI=1S/C33H33F2N5O4/c34-24-5-2-22(3-6-24)19-28(41)33(9-10-33)29(42)20-23-4-7-26(25(35)18-23)44-27-8-12-37-32-31(27)38-21-30(39-32)36-11-1-13-40-14-16-43-17-15-40/h2-8,12,18,21H,1,9-11,13-17,19-20H2,(H,36,37,39) |
| InChIKey | BGVQTBXLJYBCTQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.65 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|