C40H40N2O6 — CID 157345440
methyl 2-(1H-indol-3-yl)-4-phenylbutanoate;methyl 3-(1-methoxy-1-oxo-4-phenylbutan-2-yl)indole-1-carboxylate (PubChem CID 157345440) has the molecular formula C40H40N2O6 and a molecular weight of 644.77 g/mol. Its IUPAC name is methyl 2-(1H-indol-3-yl)-4-phenylbutanoate;methyl 3-(1-methoxy-1-oxo-4-phenylbutan-2-yl)indole-1-carboxylate.
| Compound Name | methyl 2-(1H-indol-3-yl)-4-phenylbutanoate;methyl 3-(1-methoxy-1-oxo-4-phenylbutan-2-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 157345440 |
| Molecular Formula | C40H40N2O6 |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.29 |
| IUPAC Name | methyl 2-(1H-indol-3-yl)-4-phenylbutanoate;methyl 3-(1-methoxy-1-oxo-4-phenylbutan-2-yl)indole-1-carboxylate |
| SMILES | COC(=O)C(CCc1ccccc1)c1c[nH]c2ccccc12.COC(=O)C(CCc1ccccc1)c1cn(C(=O)OC)c2ccccc12 |
| InChI | InChI=1S/C21H21NO4.C19H19NO2/c1-25-20(23)17(13-12-15-8-4-3-5-9-15)18-14-22(21(24)26-2)19-11-7-6-10-16(18)19;1-22-19(21)16(12-11-14-7-3-2-4-8-14)17-13-20-18-10-6-5-9-15(17)18/h3-11,14,17H,12-13H2,1-2H3;2-10,13,16,20H,11-12H2,1H3 |
| InChIKey | BGXGOQYFOIOHFP-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|