C21H22F3N5O4 — CID 157346098
(9S)-N-[4-(2-hydroxyethoxy)-2-pyridinyl]-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 157346098) has the molecular formula C21H22F3N5O4 and a molecular weight of 465.43 g/mol. Its IUPAC name is (9S)-N-[4-(2-hydroxyethoxy)-2-pyridinyl]-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[4-(2-hydroxyethoxy)-2-pyridinyl]-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 157346098 |
| Molecular Formula | C21H22F3N5O4 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (9S)-N-[4-(2-hydroxyethoxy)-2-pyridinyl]-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(CCC(F)(F)F)c1ccc2c(n1)N(C(=O)Nc1cc(OCCO)ccn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C21H22F3N5O4/c22-21(23,24)6-3-17(31)15-1-2-16-19(26-15)29(13-5-8-28(16)12-13)20(32)27-18-11-14(4-7-25-18)33-10-9-30/h1-2,4,7,11,13,30H,3,5-6,8-10,12H2,(H,25,27,32)/t13-/m0/s1 |
| InChIKey | DIKXBWKNVJTHKP-ZDUSSCGKSA-N |
| XLogP | 3.00 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |