C19H17N3O2 — CID 157346350
2-amino-3,5-bis(4-aminophenyl)benzoic acid (PubChem CID 157346350) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-amino-3,5-bis(4-aminophenyl)benzoic acid.
| Compound Name | 2-amino-3,5-bis(4-aminophenyl)benzoic acid |
|---|---|
| PubChem CID | 157346350 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-amino-3,5-bis(4-aminophenyl)benzoic acid |
| SMILES | Nc1ccc(-c2cc(C(=O)O)c(N)c(-c3ccc(N)cc3)c2)cc1 |
| InChI | InChI=1S/C19H17N3O2/c20-14-5-1-11(2-6-14)13-9-16(12-3-7-15(21)8-4-12)18(22)17(10-13)19(23)24/h1-10H,20-22H2,(H,23,24) |
| InChIKey | BHACAHBXBPBNEK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|