C35H29F2N3O3 — CID 157346817
(E)-5-[5-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-7-pyridin-4-yl-1-benzofuran-2-yl]-1-pyridin-3-ylpent-1-en-3-one (PubChem CID 157346817) has the molecular formula C35H29F2N3O3 and a molecular weight of 577.63 g/mol. Its IUPAC name is (E)-5-[5-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-7-pyridin-4-yl-1-benzofuran-2-yl]-1-pyridin-3-ylpent-1-en-3-one.
| Compound Name | (E)-5-[5-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-7-pyridin-4-yl-1-benzofuran-2-yl]-1-pyridin-3-ylpent-1-en-3-one |
|---|---|
| PubChem CID | 157346817 |
| Molecular Formula | C35H29F2N3O3 |
| Molecular Weight | 577.63 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | (E)-5-[5-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-7-pyridin-4-yl-1-benzofuran-2-yl]-1-pyridin-3-ylpent-1-en-3-one |
| SMILES | O=C(/C=C/c1cccnc1)CCc1cc2cc(-c3ccc(C(=O)N4CCC(F)(F)CC4)cc3)cc(-c3ccncc3)c2o1 |
| InChI | InChI=1S/C35H29F2N3O3/c36-35(37)13-18-40(19-14-35)34(42)27-6-4-25(5-7-27)28-20-29-21-31(10-9-30(41)8-3-24-2-1-15-39-23-24)43-33(29)32(22-28)26-11-16-38-17-12-26/h1-8,11-12,15-17,20-23H,9-10,13-14,18-19H2/b8-3+ |
| InChIKey | UHYZAMCXPVVYOP-FPYGCLRLSA-N |
| XLogP | 7.64 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.63 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|