C19H21N5O4 — CID 157354109
N-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]pyridine-2-carboxamide;formic acid (PubChem CID 157354109) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is N-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]pyridine-2-carboxamide;formic acid.
| Compound Name | N-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]pyridine-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 157354109 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]pyridine-2-carboxamide;formic acid |
| SMILES | CN1C(=O)C[C@@](C)(c2cccc(NC(=O)c3ccccn3)c2)N=C1N.O=CO |
| InChI | InChI=1S/C18H19N5O2.CH2O2/c1-18(11-15(24)23(2)17(19)22-18)12-6-5-7-13(10-12)21-16(25)14-8-3-4-9-20-14;2-1-3/h3-10H,11H2,1-2H3,(H2,19,22)(H,21,25);1H,(H,2,3)/t18-;/m0./s1 |
| InChIKey | BHWKPTOBACFKRE-FERBBOLQSA-N |
| XLogP | 1.43 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|