C19H20N4O2 — CID 143213351
N-[3-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]phenyl]formamide (PubChem CID 143213351) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is N-[3-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]phenyl]formamide.
| Compound Name | N-[3-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]phenyl]formamide |
|---|---|
| PubChem CID | 143213351 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[3-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]phenyl]formamide |
| SMILES | CN1C(=O)C[C@@](C)(c2cccc(-c3cccc(NC=O)c3)c2)N=C1N |
| InChI | InChI=1S/C19H20N4O2/c1-19(11-17(25)23(2)18(20)22-19)15-7-3-5-13(9-15)14-6-4-8-16(10-14)21-12-24/h3-10,12H,11H2,1-2H3,(H2,20,22)(H,21,24)/t19-/m0/s1 |
| InChIKey | MKWDDSOTFQFBEI-IBGZPJMESA-N |
| XLogP | 2.31 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|