C22H22F3N5O2 — CID 157354392
(9S)-5-[(3R)-3-cyclopropyl-4,4,4-trifluorobutanoyl]-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 157354392) has the molecular formula C22H22F3N5O2 and a molecular weight of 445.45 g/mol. Its IUPAC name is (9S)-5-[(3R)-3-cyclopropyl-4,4,4-trifluorobutanoyl]-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-[(3R)-3-cyclopropyl-4,4,4-trifluorobutanoyl]-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 157354392 |
| Molecular Formula | C22H22F3N5O2 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (9S)-5-[(3R)-3-cyclopropyl-4,4,4-trifluorobutanoyl]-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(C[C@H](C1CC1)C(F)(F)F)c1ccc2c(n1)N(C(=O)Nc1ccccn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C22H22F3N5O2/c23-22(24,25)15(13-4-5-13)11-18(31)16-6-7-17-20(27-16)30(14-8-10-29(17)12-14)21(32)28-19-3-1-2-9-26-19/h1-3,6-7,9,13-15H,4-5,8,10-12H2,(H,26,28,32)/t14-,15+/m0/s1 |
| InChIKey | IIZRAASLKIENFS-LSDHHAIUSA-N |
| XLogP | 4.27 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |