C15H27NO2 — CID 157356680
3,4-bis(2-methylpropyl)-1-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 157356680) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 3,4-bis(2-methylpropyl)-1-propan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 3,4-bis(2-methylpropyl)-1-propan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 157356680 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 3,4-bis(2-methylpropyl)-1-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | CC(C)CC1C(=O)N(C(C)C)C(=O)C1CC(C)C |
| InChI | InChI=1S/C15H27NO2/c1-9(2)7-12-13(8-10(3)4)15(18)16(11(5)6)14(12)17/h9-13H,7-8H2,1-6H3 |
| InChIKey | UFNGCJFFDRIYKK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|