C28H41NO6 — CID 157356713
trans-methyl (1R,2S)-1-[2-[(2S,4S)-1-[(2S)-2-[2-[[(1S,5R)-3-bicyclo[3.1.0]hexanyl]oxy]-2-oxoethyl]-3,3-dimethylbutanoyl]-4-methylpyrrolidin-2-yl]-2-oxoethyl]-2-ethenylcyclopropane-1-carboxylate (PubChem CID 157356713) has the molecular formula C28H41NO6 and a molecular weight of 487.64 g/mol. Its IUPAC name is trans-methyl (1R,2S)-1-[2-[(2S,4S)-1-[(2S)-2-[2-[[(1S,5R)-3-bicyclo[3.1.0]hexanyl]oxy]-2-oxoethyl]-3,3-dimethylbutanoyl]-4-methylpyrrolidin-2-yl]-2-oxoethyl]-2-ethenylcyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1R,2S)-1-[2-[(2S,4S)-1-[(2S)-2-[2-[[(1S,5R)-3-bicyclo[3.1.0]hexanyl]oxy]-2-oxoethyl]-3,3-dimethylbutanoyl]-4-methylpyrrolidin-2-yl]-2-oxoethyl]-2-ethenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 157356713 |
| Molecular Formula | C28H41NO6 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | trans-methyl (1R,2S)-1-[2-[(2S,4S)-1-[(2S)-2-[2-[[(1S,5R)-3-bicyclo[3.1.0]hexanyl]oxy]-2-oxoethyl]-3,3-dimethylbutanoyl]-4-methylpyrrolidin-2-yl]-2-oxoethyl]-2-ethenylcyclopropane-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@]1(CC(=O)[C@@H]1C[C@H](C)CN1C(=O)[C@@H](CC(=O)OC1C[C@@H]2C[C@@H]2C1)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C28H41NO6/c1-7-19-13-28(19,26(33)34-6)14-23(30)22-8-16(2)15-29(22)25(32)21(27(3,4)5)12-24(31)35-20-10-17-9-18(17)11-20/h7,16-22H,1,8-15H2,2-6H3/t16-,17-,18+,19+,20?,21+,22-,28+/m0/s1 |
| InChIKey | HATVACXFEBIHPY-YKOZDXAVSA-N |
| XLogP | 3.94 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|