C20H24FN5O2 — CID 157357015
3-[[1-[5-(dimethylamino)pentyl]-5-fluoroindazol-3-yl]methyl]pyridazine-4-carboxylic acid (PubChem CID 157357015) has the molecular formula C20H24FN5O2 and a molecular weight of 385.44 g/mol. Its IUPAC name is 3-[[1-[5-(dimethylamino)pentyl]-5-fluoroindazol-3-yl]methyl]pyridazine-4-carboxylic acid.
| Compound Name | 3-[[1-[5-(dimethylamino)pentyl]-5-fluoroindazol-3-yl]methyl]pyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 157357015 |
| Molecular Formula | C20H24FN5O2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 3-[[1-[5-(dimethylamino)pentyl]-5-fluoroindazol-3-yl]methyl]pyridazine-4-carboxylic acid |
| SMILES | CN(C)CCCCCn1nc(Cc2nnccc2C(=O)O)c2cc(F)ccc21 |
| InChI | InChI=1S/C20H24FN5O2/c1-25(2)10-4-3-5-11-26-19-7-6-14(21)12-16(19)18(24-26)13-17-15(20(27)28)8-9-22-23-17/h6-9,12H,3-5,10-11,13H2,1-2H3,(H,27,28) |
| InChIKey | GAGPQSBNUQQWRG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|