C19H22FN5O3 — CID 158913772
3-[[1-[2-[2-(dimethylamino)ethoxy]ethyl]-5-fluoroindazol-3-yl]methyl]pyridazine-4-carboxylic acid (PubChem CID 158913772) has the molecular formula C19H22FN5O3 and a molecular weight of 387.42 g/mol. Its IUPAC name is 3-[[1-[2-[2-(dimethylamino)ethoxy]ethyl]-5-fluoroindazol-3-yl]methyl]pyridazine-4-carboxylic acid.
| Compound Name | 3-[[1-[2-[2-(dimethylamino)ethoxy]ethyl]-5-fluoroindazol-3-yl]methyl]pyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 158913772 |
| Molecular Formula | C19H22FN5O3 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-[[1-[2-[2-(dimethylamino)ethoxy]ethyl]-5-fluoroindazol-3-yl]methyl]pyridazine-4-carboxylic acid |
| SMILES | CN(C)CCOCCn1nc(Cc2nnccc2C(=O)O)c2cc(F)ccc21 |
| InChI | InChI=1S/C19H22FN5O3/c1-24(2)7-9-28-10-8-25-18-4-3-13(20)11-15(18)17(23-25)12-16-14(19(26)27)5-6-21-22-16/h3-6,11H,7-10,12H2,1-2H3,(H,26,27) |
| InChIKey | XGZBMRGYZZDMEE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|