C17H19NO3 — CID 157358336
methyl (E)-4-[(5,6-dimethyl-3H-indene-1-carbonyl)amino]but-2-enoate (PubChem CID 157358336) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is methyl (E)-4-[(5,6-dimethyl-3H-indene-1-carbonyl)amino]but-2-enoate.
| Compound Name | methyl (E)-4-[(5,6-dimethyl-3H-indene-1-carbonyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 157358336 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | methyl (E)-4-[(5,6-dimethyl-3H-indene-1-carbonyl)amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)C1=CCc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C17H19NO3/c1-11-9-13-6-7-14(15(13)10-12(11)2)17(20)18-8-4-5-16(19)21-3/h4-5,7,9-10H,6,8H2,1-3H3,(H,18,20)/b5-4+ |
| InChIKey | VXGJQLSZHKYVLY-SNAWJCMRSA-N |
| XLogP | 2.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|