C21H18F3N3O7S — CID 157362355
4-(pyrimidin-2-ylmethyl)-7-[4-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazepin-5-one;sulfuric acid (PubChem CID 157362355) has the molecular formula C21H18F3N3O7S and a molecular weight of 513.45 g/mol. Its IUPAC name is 4-(pyrimidin-2-ylmethyl)-7-[4-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazepin-5-one;sulfuric acid.
| Compound Name | 4-(pyrimidin-2-ylmethyl)-7-[4-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazepin-5-one;sulfuric acid |
|---|---|
| PubChem CID | 157362355 |
| Molecular Formula | C21H18F3N3O7S |
| Molecular Weight | 513.45 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | 4-(pyrimidin-2-ylmethyl)-7-[4-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazepin-5-one;sulfuric acid |
| SMILES | O=C1c2cc(-c3ccc(OC(F)(F)F)cc3)ccc2OCCN1Cc1ncccn1.O=S(=O)(O)O |
| InChI | InChI=1S/C21H16F3N3O3.H2O4S/c22-21(23,24)30-16-5-2-14(3-6-16)15-4-7-18-17(12-15)20(28)27(10-11-29-18)13-19-25-8-1-9-26-19;1-5(2,3)4/h1-9,12H,10-11,13H2;(H2,1,2,3,4) |
| InChIKey | BIUAUMGLCKTUSI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|