C21H16F3N3O3 — CID 140849583
3,3-dideuterio-4-[dideuterio(pyrimidin-2-yl)methyl]-7-[2,3,5,6-tetradeuterio-4-(trifluoromethoxy)phenyl]-2H-1,4-benzoxazepin-5-one (PubChem CID 140849583) has the molecular formula C21H16F3N3O3 and a molecular weight of 423.42 g/mol. Its IUPAC name is 3,3-dideuterio-4-[dideuterio(pyrimidin-2-yl)methyl]-7-[2,3,5,6-tetradeuterio-4-(trifluoromethoxy)phenyl]-2H-1,4-benzoxazepin-5-one.
| Compound Name | 3,3-dideuterio-4-[dideuterio(pyrimidin-2-yl)methyl]-7-[2,3,5,6-tetradeuterio-4-(trifluoromethoxy)phenyl]-2H-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 140849583 |
| Molecular Formula | C21H16F3N3O3 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 3,3-dideuterio-4-[dideuterio(pyrimidin-2-yl)methyl]-7-[2,3,5,6-tetradeuterio-4-(trifluoromethoxy)phenyl]-2H-1,4-benzoxazepin-5-one |
| SMILES | [2H]c1c([2H])c(-c2ccc3c(c2)C(=O)N(C([2H])([2H])c2ncccn2)C([2H])([2H])CO3)c([2H])c([2H])c1OC(F)(F)F |
| InChI | InChI=1S/C21H16F3N3O3/c22-21(23,24)30-16-5-2-14(3-6-16)15-4-7-18-17(12-15)20(28)27(10-11-29-18)13-19-25-8-1-9-26-19/h1-9,12H,10-11,13H2/i2D,3D,5D,6D,10D2,13D2 |
| InChIKey | YNUAEEJQYHYLMS-FGPIKLCLSA-N |
| XLogP | 4.08 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |