C22H19F2N3O3 — CID 161234937
2,2-dideuterio-4-[dideuterio(pyrimidin-2-yl)methyl]-7-[2,3,5,6-tetradeuterio-4-(1,1-difluoroethoxy)phenyl]-3H-1,4-benzoxazepin-5-one (PubChem CID 161234937) has the molecular formula C22H19F2N3O3 and a molecular weight of 419.46 g/mol. Its IUPAC name is 2,2-dideuterio-4-[dideuterio(pyrimidin-2-yl)methyl]-7-[2,3,5,6-tetradeuterio-4-(1,1-difluoroethoxy)phenyl]-3H-1,4-benzoxazepin-5-one.
| Compound Name | 2,2-dideuterio-4-[dideuterio(pyrimidin-2-yl)methyl]-7-[2,3,5,6-tetradeuterio-4-(1,1-difluoroethoxy)phenyl]-3H-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 161234937 |
| Molecular Formula | C22H19F2N3O3 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 2,2-dideuterio-4-[dideuterio(pyrimidin-2-yl)methyl]-7-[2,3,5,6-tetradeuterio-4-(1,1-difluoroethoxy)phenyl]-3H-1,4-benzoxazepin-5-one |
| SMILES | [2H]c1c([2H])c(-c2ccc3c(c2)C(=O)N(C([2H])([2H])c2ncccn2)CC([2H])([2H])O3)c([2H])c([2H])c1OC(C)(F)F |
| InChI | InChI=1S/C22H19F2N3O3/c1-22(23,24)30-17-6-3-15(4-7-17)16-5-8-19-18(13-16)21(28)27(11-12-29-19)14-20-25-9-2-10-26-20/h2-10,13H,11-12,14H2,1H3/i3D,4D,6D,7D,12D2,14D2 |
| InChIKey | MSDZXRNOQVALNW-PPTPNTGVSA-N |
| XLogP | 4.17 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |