C22H19F2N3O3 — CID 161234932
4-[dideuterio-(4,5,6-trideuteriopyrimidin-2-yl)methyl]-7-[2,3,5,6-tetradeuterio-4-(1,1-difluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 161234932) has the molecular formula C22H19F2N3O3 and a molecular weight of 420.46 g/mol. Its IUPAC name is 4-[dideuterio-(4,5,6-trideuteriopyrimidin-2-yl)methyl]-7-[2,3,5,6-tetradeuterio-4-(1,1-difluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazepin-5-one.
| Compound Name | 4-[dideuterio-(4,5,6-trideuteriopyrimidin-2-yl)methyl]-7-[2,3,5,6-tetradeuterio-4-(1,1-difluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 161234932 |
| Molecular Formula | C22H19F2N3O3 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 4-[dideuterio-(4,5,6-trideuteriopyrimidin-2-yl)methyl]-7-[2,3,5,6-tetradeuterio-4-(1,1-difluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | [2H]c1nc(C([2H])([2H])N2CCOc3ccc(-c4c([2H])c([2H])c(OC(C)(F)F)c([2H])c4[2H])cc3C2=O)nc([2H])c1[2H] |
| InChI | InChI=1S/C22H19F2N3O3/c1-22(23,24)30-17-6-3-15(4-7-17)16-5-8-19-18(13-16)21(28)27(11-12-29-19)14-20-25-9-2-10-26-20/h2-10,13H,11-12,14H2,1H3/i2D,3D,4D,6D,7D,9D,10D,14D2 |
| InChIKey | MSDZXRNOQVALNW-CLBRYZBJSA-N |
| XLogP | 4.17 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |