About 2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane
2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane (PubChem CID 157363858) has the molecular formula C16H17Br2F2O2P
and a molecular weight of 470.09 g/mol. Its IUPAC name is 2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane.
Molecular Properties
| Compound Name | 2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane |
| PubChem CID | 157363858 |
| Molecular Formula | C16H17Br2F2O2P |
| Molecular Weight | 470.09 g/mol |
| Exact Mass | 467.93 |
| IUPAC Name | 2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane |
| SMILES | CPC.O=Cc1cccc(F)c1Br.OCc1cccc(F)c1Br |
| InChI | InChI=1S/C7H6BrFO.C7H4BrFO.C2H7P/c2*8-7-5(4-10)2-1-3-6(7)9;1-3-2/h1-3,10H,4H2;1-4H;3H,1-2H3 |
| InChIKey | BIYJGGAFYUILRQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.09 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane?
The IUPAC name of 2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane (CID 157363858) is 2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane.
What is the SMILES notation for 2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane?
The canonical SMILES for 2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane is CPC.O=Cc1cccc(F)c1Br.OCc1cccc(F)c1Br.
What is the InChIKey of 2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane?
The InChIKey is BIYJGGAFYUILRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrFO.C7H4BrFO.C2H7P/c2*8-7-5(4-10)2-1-3-6(7)9;1-3-2/h1-3,10H,4H2;1-4H;3H,1-2H3.
What are the key properties of 2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane?
2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane has a molecular weight of 470.09 g/mol, XLogP of 5.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-fluorobenzaldehyde;(2-bromo-3-fluorophenyl)methanol;dimethylphosphane is sourced from PubChem (CID 157363858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).