C10H15N5 — CID 157364839
5-N-cyclopenta-1,4-dien-1-yl-3-N,3-N,4-trimethyl-1,2,4-triazole-3,5-diamine (PubChem CID 157364839) has the molecular formula C10H15N5 and a molecular weight of 205.27 g/mol. Its IUPAC name is 5-N-cyclopenta-1,4-dien-1-yl-3-N,3-N,4-trimethyl-1,2,4-triazole-3,5-diamine.
| Compound Name | 5-N-cyclopenta-1,4-dien-1-yl-3-N,3-N,4-trimethyl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 157364839 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 5-N-cyclopenta-1,4-dien-1-yl-3-N,3-N,4-trimethyl-1,2,4-triazole-3,5-diamine |
| SMILES | CN(C)c1nnc(NC2=CCC=C2)n1C |
| InChI | InChI=1S/C10H15N5/c1-14(2)10-13-12-9(15(10)3)11-8-6-4-5-7-8/h4,6-7H,5H2,1-3H3,(H,11,12) |
| InChIKey | SGTRMULTZJVDRC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |