C23H38O2S — CID 157367046
1-[(3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-(methylsulfanylmethoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 157367046) has the molecular formula C23H38O2S and a molecular weight of 378.62 g/mol. Its IUPAC name is 1-[(3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-(methylsulfanylmethoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-(methylsulfanylmethoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 157367046 |
| Molecular Formula | C23H38O2S |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 1-[(3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-(methylsulfanylmethoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CSCO[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](C(C)=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C23H38O2S/c1-15(24)19-7-8-20-18-6-5-16-13-17(25-14-26-4)9-11-22(16,2)21(18)10-12-23(19,20)3/h16-21H,5-14H2,1-4H3/t16-,17-,18-,19+,20-,21-,22-,23+/m0/s1 |
| InChIKey | IUJSRKHQOYKHQH-POBGKJHXSA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|