C58H92O6 — CID 174158972
[(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-cyclopentylpropanoate (PubChem CID 174158972) has the molecular formula C58H92O6 and a molecular weight of 885.37 g/mol. Its IUPAC name is [(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-cyclopentylpropanoate.
| Compound Name | [(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 174158972 |
| Molecular Formula | C58H92O6 |
| Molecular Weight | 885.37 g/mol |
| Exact Mass | 884.69 |
| IUPAC Name | [(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-cyclopentylpropanoate |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](OC(=O)CCC5CCCC5)CC[C@]4(C)[C@H]3CC[C@]12C.CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](OC(=O)CCC5CCCC5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/2C29H46O3/c2*1-19(30)24-11-12-25-23-10-9-21-18-22(32-27(31)13-8-20-6-4-5-7-20)14-16-28(21,2)26(23)15-17-29(24,25)3/h2*20-26H,4-18H2,1-3H3/t2*21-,22+,23-,24+,25-,26-,28-,29+/m00/s1 |
| InChIKey | LBHNVPXNAYFILQ-DKHPSHPJSA-N |
| XLogP | 14.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.37 |
| LogP ≤ 5 | 14.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |