About 1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol
1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol (PubChem CID 157371740) has the molecular formula C16H30O3
and a molecular weight of 270.41 g/mol. Its IUPAC name is 1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol.
Molecular Properties
| Compound Name | 1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol |
| PubChem CID | 157371740 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol |
| SMILES | CC1(C(=O)O)CCCCC1.CC1(CO)CCCCC1 |
| InChI | InChI=1S/C8H14O2.C8H16O/c1-8(7(9)10)5-3-2-4-6-8;1-8(7-9)5-3-2-4-6-8/h2-6H2,1H3,(H,9,10);9H,2-7H2,1H3 |
| InChIKey | BJVQALDQGIZOLI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol?
The IUPAC name of 1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol (CID 157371740) is 1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol.
What is the SMILES notation for 1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol?
The canonical SMILES for 1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol is CC1(C(=O)O)CCCCC1.CC1(CO)CCCCC1.
What is the InChIKey of 1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol?
The InChIKey is BJVQALDQGIZOLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C8H16O/c1-8(7(9)10)5-3-2-4-6-8;1-8(7-9)5-3-2-4-6-8/h2-6H2,1H3,(H,9,10);9H,2-7H2,1H3.
What are the key properties of 1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol?
1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol has a molecular weight of 270.41 g/mol, XLogP of 3.99, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcyclohexane-1-carboxylic acid;(1-methylcyclohexyl)methanol is sourced from PubChem (CID 157371740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).