C20H26ClNO5 — CID 157375996
tert-butyl 4-oxo-3-pent-4-ynoylpiperidine-1-carboxylate;pent-4-ynoyl chloride (PubChem CID 157375996) has the molecular formula C20H26ClNO5 and a molecular weight of 395.88 g/mol. Its IUPAC name is tert-butyl 4-oxo-3-pent-4-ynoylpiperidine-1-carboxylate;pent-4-ynoyl chloride.
| Compound Name | tert-butyl 4-oxo-3-pent-4-ynoylpiperidine-1-carboxylate;pent-4-ynoyl chloride |
|---|---|
| PubChem CID | 157375996 |
| Molecular Formula | C20H26ClNO5 |
| Molecular Weight | 395.88 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | tert-butyl 4-oxo-3-pent-4-ynoylpiperidine-1-carboxylate;pent-4-ynoyl chloride |
| SMILES | C#CCCC(=O)C1CN(C(=O)OC(C)(C)C)CCC1=O.C#CCCC(=O)Cl |
| InChI | InChI=1S/C15H21NO4.C5H5ClO/c1-5-6-7-12(17)11-10-16(9-8-13(11)18)14(19)20-15(2,3)4;1-2-3-4-5(6)7/h1,11H,6-10H2,2-4H3;1H,3-4H2 |
| InChIKey | BKIHWYFFDKDFQL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.88 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|