C50H58N8O7 — CID 157376890
methyl 7-aminoheptanoate;methyl 7-[[2-(N-phenylanilino)pyrimidine-5-carbonyl]amino]heptanoate;2-(N-phenylanilino)pyrimidine-5-carboxylic acid (PubChem CID 157376890) has the molecular formula C50H58N8O7 and a molecular weight of 883.06 g/mol. Its IUPAC name is methyl 7-aminoheptanoate;methyl 7-[[2-(N-phenylanilino)pyrimidine-5-carbonyl]amino]heptanoate;2-(N-phenylanilino)pyrimidine-5-carboxylic acid.
| Compound Name | methyl 7-aminoheptanoate;methyl 7-[[2-(N-phenylanilino)pyrimidine-5-carbonyl]amino]heptanoate;2-(N-phenylanilino)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 157376890 |
| Molecular Formula | C50H58N8O7 |
| Molecular Weight | 883.06 g/mol |
| Exact Mass | 882.44 |
| IUPAC Name | methyl 7-aminoheptanoate;methyl 7-[[2-(N-phenylanilino)pyrimidine-5-carbonyl]amino]heptanoate;2-(N-phenylanilino)pyrimidine-5-carboxylic acid |
| SMILES | COC(=O)CCCCCCN.COC(=O)CCCCCCNC(=O)c1cnc(N(c2ccccc2)c2ccccc2)nc1.O=C(O)c1cnc(N(c2ccccc2)c2ccccc2)nc1 |
| InChI | InChI=1S/C25H28N4O3.C17H13N3O2.C8H17NO2/c1-32-23(30)16-10-2-3-11-17-26-24(31)20-18-27-25(28-19-20)29(21-12-6-4-7-13-21)22-14-8-5-9-15-22;21-16(22)13-11-18-17(19-12-13)20(14-7-3-1-4-8-14)15-9-5-2-6-10-15;1-11-8(10)6-4-2-3-5-7-9/h4-9,12-15,18-19H,2-3,10-11,16-17H2,1H3,(H,26,31);1-12H,(H,21,22);2-7,9H2,1H3 |
| InChIKey | BKKSRSILBFEGMD-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 203.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.06 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|