C31H40F2N2O4 — CID 157377565
tert-butyl 3,3-difluoro-4-[5-oxo-5-[2-[(1S)-1-phenylethyl]-6-propanoyl-4-pyridinyl]pentyl]piperidine-1-carboxylate (PubChem CID 157377565) has the molecular formula C31H40F2N2O4 and a molecular weight of 542.67 g/mol. Its IUPAC name is tert-butyl 3,3-difluoro-4-[5-oxo-5-[2-[(1S)-1-phenylethyl]-6-propanoyl-4-pyridinyl]pentyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3,3-difluoro-4-[5-oxo-5-[2-[(1S)-1-phenylethyl]-6-propanoyl-4-pyridinyl]pentyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 157377565 |
| Molecular Formula | C31H40F2N2O4 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | tert-butyl 3,3-difluoro-4-[5-oxo-5-[2-[(1S)-1-phenylethyl]-6-propanoyl-4-pyridinyl]pentyl]piperidine-1-carboxylate |
| SMILES | CCC(=O)c1cc(C(=O)CCCCC2CCN(C(=O)OC(C)(C)C)CC2(F)F)cc([C@@H](C)c2ccccc2)n1 |
| InChI | InChI=1S/C31H40F2N2O4/c1-6-27(36)26-19-23(18-25(34-26)21(2)22-12-8-7-9-13-22)28(37)15-11-10-14-24-16-17-35(20-31(24,32)33)29(38)39-30(3,4)5/h7-9,12-13,18-19,21,24H,6,10-11,14-17,20H2,1-5H3/t21-,24?/m0/s1 |
| InChIKey | BKMNADVLNMYAOV-XEGCMXMBSA-N |
| XLogP | 7.46 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|