C35H45FN4O6 — CID 157378788
methyl (2S)-2-[[(2S)-4-[(3E,5S)-5-[(3-fluorophenyl)methyl]-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]-1-(3-methylphenyl)-3-oxobutan-2-yl]carbamoylamino]-3-methylbutanoate (PubChem CID 157378788) has the molecular formula C35H45FN4O6 and a molecular weight of 636.77 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-4-[(3E,5S)-5-[(3-fluorophenyl)methyl]-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]-1-(3-methylphenyl)-3-oxobutan-2-yl]carbamoylamino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[(2S)-4-[(3E,5S)-5-[(3-fluorophenyl)methyl]-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]-1-(3-methylphenyl)-3-oxobutan-2-yl]carbamoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 157378788 |
| Molecular Formula | C35H45FN4O6 |
| Molecular Weight | 636.77 g/mol |
| Exact Mass | 636.33 |
| IUPAC Name | methyl (2S)-2-[[(2S)-4-[(3E,5S)-5-[(3-fluorophenyl)methyl]-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]-1-(3-methylphenyl)-3-oxobutan-2-yl]carbamoylamino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)N[C@@H](Cc1cccc(C)c1)C(=O)CC1CCCCNC(=O)/C=C/[C@H](Cc2cccc(F)c2)NC1=O)C(C)C |
| InChI | InChI=1S/C35H45FN4O6/c1-22(2)32(34(44)46-4)40-35(45)39-29(20-24-10-7-9-23(3)17-24)30(41)21-26-12-5-6-16-37-31(42)15-14-28(38-33(26)43)19-25-11-8-13-27(36)18-25/h7-11,13-15,17-18,22,26,28-29,32H,5-6,12,16,19-21H2,1-4H3,(H,37,42)(H,38,43)(H2,39,40,45)/b15-14+/t26?,28-,29+,32+/m1/s1 |
| InChIKey | BKQCCVDTIHCFGO-ZXZFLNCVSA-N |
| XLogP | 3.70 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |