C29H33BCl2N2O2 — CID 157378902
2-chloro-5-methylpyridine;2-chloro-5-(2,4,6-trimethylphenyl)pyridine;(2,4,6-trimethylphenyl)boronic acid (PubChem CID 157378902) has the molecular formula C29H33BCl2N2O2 and a molecular weight of 523.31 g/mol. Its IUPAC name is 2-chloro-5-methylpyridine;2-chloro-5-(2,4,6-trimethylphenyl)pyridine;(2,4,6-trimethylphenyl)boronic acid.
| Compound Name | 2-chloro-5-methylpyridine;2-chloro-5-(2,4,6-trimethylphenyl)pyridine;(2,4,6-trimethylphenyl)boronic acid |
|---|---|
| PubChem CID | 157378902 |
| Molecular Formula | C29H33BCl2N2O2 |
| Molecular Weight | 523.31 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 2-chloro-5-methylpyridine;2-chloro-5-(2,4,6-trimethylphenyl)pyridine;(2,4,6-trimethylphenyl)boronic acid |
| SMILES | Cc1cc(C)c(-c2ccc(Cl)nc2)c(C)c1.Cc1cc(C)c(B(O)O)c(C)c1.Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H14ClN.C9H13BO2.C6H6ClN/c1-9-6-10(2)14(11(3)7-9)12-4-5-13(15)16-8-12;1-6-4-7(2)9(10(11)12)8(3)5-6;1-5-2-3-6(7)8-4-5/h4-8H,1-3H3;4-5,11-12H,1-3H3;2-4H,1H3 |
| InChIKey | BKQJASIGEFWEBV-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.31 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|