C16H12BBrCl4N4O2 — CID 157380115
5-bromo-3,4-dichloro-2-methylindazole;(3,4-dichloro-2-methylindazol-5-yl)boronic acid (PubChem CID 157380115) has the molecular formula C16H12BBrCl4N4O2 and a molecular weight of 524.83 g/mol. Its IUPAC name is 5-bromo-3,4-dichloro-2-methylindazole;(3,4-dichloro-2-methylindazol-5-yl)boronic acid.
| Compound Name | 5-bromo-3,4-dichloro-2-methylindazole;(3,4-dichloro-2-methylindazol-5-yl)boronic acid |
|---|---|
| PubChem CID | 157380115 |
| Molecular Formula | C16H12BBrCl4N4O2 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 521.90 |
| IUPAC Name | 5-bromo-3,4-dichloro-2-methylindazole;(3,4-dichloro-2-methylindazol-5-yl)boronic acid |
| SMILES | Cn1nc2ccc(B(O)O)c(Cl)c2c1Cl.Cn1nc2ccc(Br)c(Cl)c2c1Cl |
| InChI | InChI=1S/C8H7BCl2N2O2.C8H5BrCl2N2/c1-13-8(11)6-5(12-13)3-2-4(7(6)10)9(14)15;1-13-8(11)6-5(12-13)3-2-4(9)7(6)10/h2-3,14-15H,1H3;2-3H,1H3 |
| InChIKey | BKTYOAMVQGBXTH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|