C14H20Cl2O3 — CID 157380706
(1R,4S)-4-chlorocyclohex-2-en-1-ol;[(1R,4S)-4-chlorocyclohex-2-en-1-yl] acetate (PubChem CID 157380706) has the molecular formula C14H20Cl2O3 and a molecular weight of 307.22 g/mol. Its IUPAC name is (1R,4S)-4-chlorocyclohex-2-en-1-ol;[(1R,4S)-4-chlorocyclohex-2-en-1-yl] acetate.
| Compound Name | (1R,4S)-4-chlorocyclohex-2-en-1-ol;[(1R,4S)-4-chlorocyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 157380706 |
| Molecular Formula | C14H20Cl2O3 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (1R,4S)-4-chlorocyclohex-2-en-1-ol;[(1R,4S)-4-chlorocyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](Cl)CC1.O[C@H]1C=C[C@@H](Cl)CC1 |
| InChI | InChI=1S/C8H11ClO2.C6H9ClO/c1-6(10)11-8-4-2-7(9)3-5-8;7-5-1-3-6(8)4-2-5/h2,4,7-8H,3,5H2,1H3;1,3,5-6,8H,2,4H2/t7-,8+;5-,6+/m11/s1 |
| InChIKey | BKVULTZJJVWOOY-KBNBBVIQSA-N |
| XLogP | 3.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|