C14H19ClO2 — CID 162202414
[(1R,4S)-4-chlorocyclohex-2-en-1-yl] acetate;cyclohexa-1,3-diene (PubChem CID 162202414) has the molecular formula C14H19ClO2 and a molecular weight of 254.76 g/mol. Its IUPAC name is [(1R,4S)-4-chlorocyclohex-2-en-1-yl] acetate;cyclohexa-1,3-diene.
| Compound Name | [(1R,4S)-4-chlorocyclohex-2-en-1-yl] acetate;cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 162202414 |
| Molecular Formula | C14H19ClO2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | [(1R,4S)-4-chlorocyclohex-2-en-1-yl] acetate;cyclohexa-1,3-diene |
| SMILES | C1=CCCC=C1.CC(=O)O[C@H]1C=C[C@@H](Cl)CC1 |
| InChI | InChI=1S/C8H11ClO2.C6H8/c1-6(10)11-8-4-2-7(9)3-5-8;1-2-4-6-5-3-1/h2,4,7-8H,3,5H2,1H3;1-4H,5-6H2/t7-,8+;/m1./s1 |
| InChIKey | ZRTLQSPOTOVZCT-WLYNEOFISA-N |
| XLogP | 3.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|