C16H21ClO4 — CID 134849160
methyl (2E,4E,9R)-9-[(2Z,4E)-5-chloropenta-2,4-dienoyl]oxydeca-2,4-dienoate (PubChem CID 134849160) has the molecular formula C16H21ClO4 and a molecular weight of 312.79 g/mol. Its IUPAC name is methyl (2E,4E,9R)-9-[(2Z,4E)-5-chloropenta-2,4-dienoyl]oxydeca-2,4-dienoate.
| Compound Name | methyl (2E,4E,9R)-9-[(2Z,4E)-5-chloropenta-2,4-dienoyl]oxydeca-2,4-dienoate |
|---|---|
| PubChem CID | 134849160 |
| Molecular Formula | C16H21ClO4 |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | methyl (2E,4E,9R)-9-[(2Z,4E)-5-chloropenta-2,4-dienoyl]oxydeca-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C/CCC[C@@H](C)OC(=O)/C=C\C=C\Cl |
| InChI | InChI=1S/C16H21ClO4/c1-14(21-16(19)12-8-9-13-17)10-6-4-3-5-7-11-15(18)20-2/h3,5,7-9,11-14H,4,6,10H2,1-2H3/b5-3+,11-7+,12-8-,13-9+/t14-/m1/s1 |
| InChIKey | OHKWTBVMAFVRAS-HCIPOIAGSA-N |
| XLogP | 3.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|