About 1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol
1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol (PubChem CID 157383225) has the molecular formula C32H27BrN2O2
and a molecular weight of 551.48 g/mol. Its IUPAC name is 1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol.
Molecular Properties
| Compound Name | 1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol |
| PubChem CID | 157383225 |
| Molecular Formula | C32H27BrN2O2 |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol |
| SMILES | Cc1ccc(Br)cc1.Cc1ccc(Oc2ccc3ncccc3c2)cc1.Oc1ccc2ncccc2c1 |
| InChI | InChI=1S/C16H13NO.C9H7NO.C7H7Br/c1-12-4-6-14(7-5-12)18-15-8-9-16-13(11-15)3-2-10-17-16;11-8-3-4-9-7(6-8)2-1-5-10-9;1-6-2-4-7(8)5-3-6/h2-11H,1H3;1-6,11H;2-5H,1H3 |
| InChIKey | BLDANJPAJFEXFC-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol?
The IUPAC name of 1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol (CID 157383225) is 1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol.
What is the SMILES notation for 1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol?
The canonical SMILES for 1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol is Cc1ccc(Br)cc1.Cc1ccc(Oc2ccc3ncccc3c2)cc1.Oc1ccc2ncccc2c1.
What is the InChIKey of 1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol?
The InChIKey is BLDANJPAJFEXFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO.C9H7NO.C7H7Br/c1-12-4-6-14(7-5-12)18-15-8-9-16-13(11-15)3-2-10-17-16;11-8-3-4-9-7(6-8)2-1-5-10-9;1-6-2-4-7(8)5-3-6/h2-11H,1H3;1-6,11H;2-5H,1H3.
What are the key properties of 1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol?
1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol has a molecular weight of 551.48 g/mol, XLogP of 9.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-methylbenzene;6-(4-methylphenoxy)quinoline;quinolin-6-ol is sourced from PubChem (CID 157383225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).