C34H43N — CID 157383526
1-[1-[4-[3-(2-cyclohexylprop-2-enyl)phenyl]phenyl]ethenyl]-4-[1-(1-methylcyclopropyl)ethenyl]piperidine (PubChem CID 157383526) has the molecular formula C34H43N and a molecular weight of 465.73 g/mol. Its IUPAC name is 1-[1-[4-[3-(2-cyclohexylprop-2-enyl)phenyl]phenyl]ethenyl]-4-[1-(1-methylcyclopropyl)ethenyl]piperidine.
| Compound Name | 1-[1-[4-[3-(2-cyclohexylprop-2-enyl)phenyl]phenyl]ethenyl]-4-[1-(1-methylcyclopropyl)ethenyl]piperidine |
|---|---|
| PubChem CID | 157383526 |
| Molecular Formula | C34H43N |
| Molecular Weight | 465.73 g/mol |
| Exact Mass | 465.34 |
| IUPAC Name | 1-[1-[4-[3-(2-cyclohexylprop-2-enyl)phenyl]phenyl]ethenyl]-4-[1-(1-methylcyclopropyl)ethenyl]piperidine |
| SMILES | C=C(Cc1cccc(-c2ccc(C(=C)N3CCC(C(=C)C4(C)CC4)CC3)cc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C34H43N/c1-25(29-10-6-5-7-11-29)23-28-9-8-12-33(24-28)32-15-13-31(14-16-32)27(3)35-21-17-30(18-22-35)26(2)34(4)19-20-34/h8-9,12-16,24,29-30H,1-3,5-7,10-11,17-23H2,4H3 |
| InChIKey | BLDWYDCQFNSLSQ-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.73 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|