C31H35N — CID 175623567
3-[3-(2,2-dimethylbut-3-enyl)phenyl]-1-[1-(4-phenylphenyl)ethenyl]piperidine (PubChem CID 175623567) has the molecular formula C31H35N and a molecular weight of 421.63 g/mol. Its IUPAC name is 3-[3-(2,2-dimethylbut-3-enyl)phenyl]-1-[1-(4-phenylphenyl)ethenyl]piperidine.
| Compound Name | 3-[3-(2,2-dimethylbut-3-enyl)phenyl]-1-[1-(4-phenylphenyl)ethenyl]piperidine |
|---|---|
| PubChem CID | 175623567 |
| Molecular Formula | C31H35N |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 3-[3-(2,2-dimethylbut-3-enyl)phenyl]-1-[1-(4-phenylphenyl)ethenyl]piperidine |
| SMILES | C=CC(C)(C)Cc1cccc(C2CCCN(C(=C)c3ccc(-c4ccccc4)cc3)C2)c1 |
| InChI | InChI=1S/C31H35N/c1-5-31(3,4)22-25-11-9-14-29(21-25)30-15-10-20-32(23-30)24(2)26-16-18-28(19-17-26)27-12-7-6-8-13-27/h5-9,11-14,16-19,21,30H,1-2,10,15,20,22-23H2,3-4H3 |
| InChIKey | UKMYEPUJKYFSTO-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|