C31H33F2N — CID 175623536
1-[1-[3-(3,4-difluorophenyl)phenyl]ethenyl]-3-[3-(2,2-dimethylbut-3-enyl)phenyl]piperidine (PubChem CID 175623536) has the molecular formula C31H33F2N and a molecular weight of 457.61 g/mol. Its IUPAC name is 1-[1-[3-(3,4-difluorophenyl)phenyl]ethenyl]-3-[3-(2,2-dimethylbut-3-enyl)phenyl]piperidine.
| Compound Name | 1-[1-[3-(3,4-difluorophenyl)phenyl]ethenyl]-3-[3-(2,2-dimethylbut-3-enyl)phenyl]piperidine |
|---|---|
| PubChem CID | 175623536 |
| Molecular Formula | C31H33F2N |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 1-[1-[3-(3,4-difluorophenyl)phenyl]ethenyl]-3-[3-(2,2-dimethylbut-3-enyl)phenyl]piperidine |
| SMILES | C=CC(C)(C)Cc1cccc(C2CCCN(C(=C)c3cccc(-c4ccc(F)c(F)c4)c3)C2)c1 |
| InChI | InChI=1S/C31H33F2N/c1-5-31(3,4)20-23-9-6-11-25(17-23)28-13-8-16-34(21-28)22(2)24-10-7-12-26(18-24)27-14-15-29(32)30(33)19-27/h5-7,9-12,14-15,17-19,28H,1-2,8,13,16,20-21H2,3-4H3 |
| InChIKey | LQNMMQFBTJBFCN-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|