C32H37F2N — CID 175623687
1-[[3-(3,4-difluorophenyl)phenyl]methyl]-3-[3-(2,2-dimethyl-3-methylidenepentyl)phenyl]piperidine (PubChem CID 175623687) has the molecular formula C32H37F2N and a molecular weight of 473.65 g/mol. Its IUPAC name is 1-[[3-(3,4-difluorophenyl)phenyl]methyl]-3-[3-(2,2-dimethyl-3-methylidenepentyl)phenyl]piperidine.
| Compound Name | 1-[[3-(3,4-difluorophenyl)phenyl]methyl]-3-[3-(2,2-dimethyl-3-methylidenepentyl)phenyl]piperidine |
|---|---|
| PubChem CID | 175623687 |
| Molecular Formula | C32H37F2N |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | 1-[[3-(3,4-difluorophenyl)phenyl]methyl]-3-[3-(2,2-dimethyl-3-methylidenepentyl)phenyl]piperidine |
| SMILES | C=C(CC)C(C)(C)Cc1cccc(C2CCCN(Cc3cccc(-c4ccc(F)c(F)c4)c3)C2)c1 |
| InChI | InChI=1S/C32H37F2N/c1-5-23(2)32(3,4)20-24-9-6-12-27(17-24)29-13-8-16-35(22-29)21-25-10-7-11-26(18-25)28-14-15-30(33)31(34)19-28/h6-7,9-12,14-15,17-19,29H,2,5,8,13,16,20-22H2,1,3-4H3 |
| InChIKey | WXQBHOGRWOLPMZ-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|